C19H28O2 — CID 101316751
(4R,7R,8R,9S,12R)-9-[(2R)-6-methylhept-5-en-2-yl]-3-oxatricyclo[5.4.1.04,12]dodeca-1(11),5-dien-8-ol (PubChem CID 101316751) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is (4R,7R,8R,9S,12R)-9-[(2R)-6-methylhept-5-en-2-yl]-3-oxatricyclo[5.4.1.04,12]dodeca-1(11),5-dien-8-ol.
| Compound Name | (4R,7R,8R,9S,12R)-9-[(2R)-6-methylhept-5-en-2-yl]-3-oxatricyclo[5.4.1.04,12]dodeca-1(11),5-dien-8-ol |
|---|---|
| PubChem CID | 101316751 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | (4R,7R,8R,9S,12R)-9-[(2R)-6-methylhept-5-en-2-yl]-3-oxatricyclo[5.4.1.04,12]dodeca-1(11),5-dien-8-ol |
| SMILES | CC(C)=CCC[C@@H](C)[C@@H]1CC=C2CO[C@@H]3C=C[C@@H]([C@@H]1O)[C@H]23 |
| InChI | InChI=1S/C19H28O2/c1-12(2)5-4-6-13(3)15-8-7-14-11-21-17-10-9-16(18(14)17)19(15)20/h5,7,9-10,13,15-20H,4,6,8,11H2,1-3H3/t13-,15+,16-,17-,18+,19-/m1/s1 |
| InChIKey | CCQZRSHKJKLNRK-PUNHEFHTSA-N |
| XLogP | 3.88 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|