C30H39O2PS2 — CID 101318270
bis(3-pentylphenoxy)-(2-phenylethylsulfanyl)-sulfanylidene-λ5-phosphane (PubChem CID 101318270) has the molecular formula C30H39O2PS2 and a molecular weight of 526.75 g/mol. Its IUPAC name is bis(3-pentylphenoxy)-(2-phenylethylsulfanyl)-sulfanylidene-λ5-phosphane.
| Compound Name | bis(3-pentylphenoxy)-(2-phenylethylsulfanyl)-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 101318270 |
| Molecular Formula | C30H39O2PS2 |
| Molecular Weight | 526.75 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | bis(3-pentylphenoxy)-(2-phenylethylsulfanyl)-sulfanylidene-λ5-phosphane |
| SMILES | CCCCCc1cccc(OP(=S)(Oc2cccc(CCCCC)c2)SCCc2ccccc2)c1 |
| InChI | InChI=1S/C30H39O2PS2/c1-3-5-8-16-27-18-12-20-29(24-27)31-33(34,35-23-22-26-14-10-7-11-15-26)32-30-21-13-19-28(25-30)17-9-6-4-2/h7,10-15,18-21,24-25H,3-6,8-9,16-17,22-23H2,1-2H3 |
| InChIKey | FBGXUYAANGCFTL-UHFFFAOYSA-N |
| XLogP | 9.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.75 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|