C17H12Cl2N4O4 — CID 101318606
N-[1-(3,5-dichloro-4-methylphenyl)-5-oxo-4H-pyrazol-3-yl]-3-nitrobenzamide (PubChem CID 101318606) has the molecular formula C17H12Cl2N4O4 and a molecular weight of 407.21 g/mol. Its IUPAC name is N-[1-(3,5-dichloro-4-methylphenyl)-5-oxo-4H-pyrazol-3-yl]-3-nitrobenzamide.
| Compound Name | N-[1-(3,5-dichloro-4-methylphenyl)-5-oxo-4H-pyrazol-3-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 101318606 |
| Molecular Formula | C17H12Cl2N4O4 |
| Molecular Weight | 407.21 g/mol |
| Exact Mass | 406.02 |
| IUPAC Name | N-[1-(3,5-dichloro-4-methylphenyl)-5-oxo-4H-pyrazol-3-yl]-3-nitrobenzamide |
| SMILES | Cc1c(Cl)cc(N2N=C(NC(=O)c3cccc([N+](=O)[O-])c3)CC2=O)cc1Cl |
| InChI | InChI=1S/C17H12Cl2N4O4/c1-9-13(18)6-12(7-14(9)19)22-16(24)8-15(21-22)20-17(25)10-3-2-4-11(5-10)23(26)27/h2-7H,8H2,1H3,(H,20,21,25) |
| InChIKey | AXAUSFQGCYICIE-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 104.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.21 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_5_B(4)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|