C20H23N3O2 — CID 10131913
methyl 8-methyl-3-(4-pyrimidin-5-ylphenyl)-8-azabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 10131913) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is methyl 8-methyl-3-(4-pyrimidin-5-ylphenyl)-8-azabicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | methyl 8-methyl-3-(4-pyrimidin-5-ylphenyl)-8-azabicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 10131913 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | methyl 8-methyl-3-(4-pyrimidin-5-ylphenyl)-8-azabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | COC(=O)C1C(c2ccc(-c3cncnc3)cc2)CC2CCC1N2C |
| InChI | InChI=1S/C20H23N3O2/c1-23-16-7-8-18(23)19(20(24)25-2)17(9-16)14-5-3-13(4-6-14)15-10-21-12-22-11-15/h3-6,10-12,16-19H,7-9H2,1-2H3 |
| InChIKey | RASOLZJESXTKBV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |