C21H24N2O2 — CID 10131866
methyl 8-methyl-3-(4-pyridin-3-ylphenyl)-8-azabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 10131866) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is methyl 8-methyl-3-(4-pyridin-3-ylphenyl)-8-azabicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | methyl 8-methyl-3-(4-pyridin-3-ylphenyl)-8-azabicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 10131866 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | methyl 8-methyl-3-(4-pyridin-3-ylphenyl)-8-azabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | COC(=O)C1C(c2ccc(-c3cccnc3)cc2)CC2CCC1N2C |
| InChI | InChI=1S/C21H24N2O2/c1-23-17-9-10-19(23)20(21(24)25-2)18(12-17)15-7-5-14(6-8-15)16-4-3-11-22-13-16/h3-8,11,13,17-20H,9-10,12H2,1-2H3 |
| InChIKey | NXORWCWVGVRNEV-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |