C20H24N2O2 — CID 52950138
methyl (2R)-2-phenyl-2-[(2R)-1-(pyridin-4-ylmethyl)piperidin-2-yl]acetate (PubChem CID 52950138) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is methyl (2R)-2-phenyl-2-[(2R)-1-(pyridin-4-ylmethyl)piperidin-2-yl]acetate.
| Compound Name | methyl (2R)-2-phenyl-2-[(2R)-1-(pyridin-4-ylmethyl)piperidin-2-yl]acetate |
|---|---|
| PubChem CID | 52950138 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | methyl (2R)-2-phenyl-2-[(2R)-1-(pyridin-4-ylmethyl)piperidin-2-yl]acetate |
| SMILES | COC(=O)[C@H](c1ccccc1)[C@H]1CCCCN1Cc1ccncc1 |
| InChI | InChI=1S/C20H24N2O2/c1-24-20(23)19(17-7-3-2-4-8-17)18-9-5-6-14-22(18)15-16-10-12-21-13-11-16/h2-4,7-8,10-13,18-19H,5-6,9,14-15H2,1H3/t18-,19-/m1/s1 |
| InChIKey | RLLOCIZJNXWKIC-RTBURBONSA-N |
| XLogP | 3.39 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |