C17H20N2O2 — CID 688595
Tropicamide, (R)- (PubChem CID 688595) has the molecular formula C17H20N2O2 and a molecular weight of 284.35 g/mol. Its IUPAC name is (2R)-N-ethyl-3-hydroxy-2-phenyl-N-(pyridin-4-ylmethyl)propanamide.
| Compound Name | Tropicamide, (R)- |
|---|---|
| PubChem CID | 688595 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | (2R)-N-ethyl-3-hydroxy-2-phenyl-N-(pyridin-4-ylmethyl)propanamide |
| SMILES | CCN(CC1=CC=NC=C1)C(=O)[C@@H](CO)C2=CC=CC=C2 |
| InChI | InChI=1S/C17H20N2O2/c1-2-19(12-14-8-10-18-11-9-14)17(21)16(13-20)15-6-4-3-5-7-15/h3-11,16,20H,2,12-13H2,1H3/t16-/m0/s1 |
| InChIKey | BGDKAVGWHJFAGW-INIZCTEOSA-N |
| XLogP | 1.50 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | 310 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |