C29H40N3O2+ — CID 57399406
[(3R)-1-(3-pyridin-3-ylpropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-phenyl-2-piperidin-1-ylpropanoate (PubChem CID 57399406) has the molecular formula C29H40N3O2+ and a molecular weight of 462.66 g/mol. Its IUPAC name is [(3R)-1-(3-pyridin-3-ylpropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-phenyl-2-piperidin-1-ylpropanoate.
| Compound Name | [(3R)-1-(3-pyridin-3-ylpropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-phenyl-2-piperidin-1-ylpropanoate |
|---|---|
| PubChem CID | 57399406 |
| Molecular Formula | C29H40N3O2+ |
| Molecular Weight | 462.66 g/mol |
| Exact Mass | 462.31 |
| IUPAC Name | [(3R)-1-(3-pyridin-3-ylpropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-phenyl-2-piperidin-1-ylpropanoate |
| SMILES | C[C@@](C(=O)O[C@H]1C[N+]2(CCCc3cccnc3)CCC1CC2)(c1ccccc1)N1CCCCC1 |
| InChI | InChI=1S/C29H40N3O2/c1-29(26-12-4-2-5-13-26,31-17-6-3-7-18-31)28(33)34-27-23-32(20-14-25(27)15-21-32)19-9-11-24-10-8-16-30-22-24/h2,4-5,8,10,12-13,16,22,25,27H,3,6-7,9,11,14-15,17-21,23H2,1H3/q+1/t25?,27-,29-,32?/m0/s1 |
| InChIKey | FKZXUTFIOSGCHU-NGWQEONKSA-N |
| XLogP | 4.57 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.66 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|