C52H78BaO6S2 — CID 101319504
barium(2+);bis(6,8-dioctylnaphthalene-2-sulfonate) (PubChem CID 101319504) has the molecular formula C52H78BaO6S2 and a molecular weight of 1000.65 g/mol. Its IUPAC name is barium(2+);bis(6,8-dioctylnaphthalene-2-sulfonate).
| Compound Name | barium(2+);bis(6,8-dioctylnaphthalene-2-sulfonate) |
|---|---|
| PubChem CID | 101319504 |
| Molecular Formula | C52H78BaO6S2 |
| Molecular Weight | 1000.65 g/mol |
| Exact Mass | 1000.43 |
| IUPAC Name | barium(2+);bis(6,8-dioctylnaphthalene-2-sulfonate) |
| SMILES | CCCCCCCCc1cc(CCCCCCCC)c2cc(S(=O)(=O)[O-])ccc2c1.CCCCCCCCc1cc(CCCCCCCC)c2cc(S(=O)(=O)[O-])ccc2c1.[Ba+2] |
| InChI | InChI=1S/2C26H40O3S.Ba/c2*1-3-5-7-9-11-13-15-22-19-23(16-14-12-10-8-6-4-2)26-21-25(30(27,28)29)18-17-24(26)20-22;/h2*17-21H,3-16H2,1-2H3,(H,27,28,29);/q;;+2/p-2 |
| InChIKey | FJVYETGIEPQWRU-UHFFFAOYSA-L |
| XLogP | 14.72 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1000.65 |
| LogP ≤ 5 | 14.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|