C24H35KO3S — CID 101324002
potassium 4,7-diheptylnaphthalene-2-sulfonate (PubChem CID 101324002) has the molecular formula C24H35KO3S and a molecular weight of 442.71 g/mol. Its IUPAC name is potassium 4,7-diheptylnaphthalene-2-sulfonate.
| Compound Name | potassium 4,7-diheptylnaphthalene-2-sulfonate |
|---|---|
| PubChem CID | 101324002 |
| Molecular Formula | C24H35KO3S |
| Molecular Weight | 442.71 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | potassium 4,7-diheptylnaphthalene-2-sulfonate |
| SMILES | CCCCCCCc1ccc2c(CCCCCCC)cc(S(=O)(=O)[O-])cc2c1.[K+] |
| InChI | InChI=1S/C24H36O3S.K/c1-3-5-7-9-11-13-20-15-16-24-21(14-12-10-8-6-4-2)18-23(28(25,26)27)19-22(24)17-20;/h15-19H,3-14H2,1-2H3,(H,25,26,27);/q;+1/p-1 |
| InChIKey | OSQGZCAWQOHOJG-UHFFFAOYSA-M |
| XLogP | 3.77 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.71 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|