C18H17FN4O2 — CID 10132032
N-[4-(1,4-dimethyl-6-oxo-4,5-dihydropyridazin-3-yl)phenyl]-6-fluoropyridine-2-carboxamide (PubChem CID 10132032) has the molecular formula C18H17FN4O2 and a molecular weight of 340.36 g/mol. Its IUPAC name is N-[4-(1,4-dimethyl-6-oxo-4,5-dihydropyridazin-3-yl)phenyl]-6-fluoropyridine-2-carboxamide.
| Compound Name | N-[4-(1,4-dimethyl-6-oxo-4,5-dihydropyridazin-3-yl)phenyl]-6-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 10132032 |
| Molecular Formula | C18H17FN4O2 |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | N-[4-(1,4-dimethyl-6-oxo-4,5-dihydropyridazin-3-yl)phenyl]-6-fluoropyridine-2-carboxamide |
| SMILES | CC1CC(=O)N(C)N=C1c1ccc(NC(=O)c2cccc(F)n2)cc1 |
| InChI | InChI=1S/C18H17FN4O2/c1-11-10-16(24)23(2)22-17(11)12-6-8-13(9-7-12)20-18(25)14-4-3-5-15(19)21-14/h3-9,11H,10H2,1-2H3,(H,20,25) |
| InChIKey | PRQBBNTZVGCJSS-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|