C15H29N3 — CID 101322960
2-[2-[(E)-dec-3-enyl]-1,2-dihydroimidazol-3-yl]ethanamine (PubChem CID 101322960) has the molecular formula C15H29N3 and a molecular weight of 251.42 g/mol. Its IUPAC name is 2-[2-[(E)-dec-3-enyl]-1,2-dihydroimidazol-3-yl]ethanamine.
| Compound Name | 2-[2-[(E)-dec-3-enyl]-1,2-dihydroimidazol-3-yl]ethanamine |
|---|---|
| PubChem CID | 101322960 |
| Molecular Formula | C15H29N3 |
| Molecular Weight | 251.42 g/mol |
| Exact Mass | 251.24 |
| IUPAC Name | 2-[2-[(E)-dec-3-enyl]-1,2-dihydroimidazol-3-yl]ethanamine |
| SMILES | CCCCCC/C=C/CCC1NC=CN1CCN |
| InChI | InChI=1S/C15H29N3/c1-2-3-4-5-6-7-8-9-10-15-17-12-14-18(15)13-11-16/h7-8,12,14-15,17H,2-6,9-11,13,16H2,1H3/b8-7+ |
| InChIKey | GKOOJMBVDYYMSG-BQYQJAHWSA-N |
| XLogP | 2.95 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.42 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|