C15H28N2O — CID 101327521
2-[2-[(E)-dec-4-enyl]-1,2-dihydroimidazol-3-yl]ethanol (PubChem CID 101327521) has the molecular formula C15H28N2O and a molecular weight of 252.40 g/mol. Its IUPAC name is 2-[2-[(E)-dec-4-enyl]-1,2-dihydroimidazol-3-yl]ethanol.
| Compound Name | 2-[2-[(E)-dec-4-enyl]-1,2-dihydroimidazol-3-yl]ethanol |
|---|---|
| PubChem CID | 101327521 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | 2-[2-[(E)-dec-4-enyl]-1,2-dihydroimidazol-3-yl]ethanol |
| SMILES | CCCCC/C=C/CCCC1NC=CN1CCO |
| InChI | InChI=1S/C15H28N2O/c1-2-3-4-5-6-7-8-9-10-15-16-11-12-17(15)13-14-18/h6-7,11-12,15-16,18H,2-5,8-10,13-14H2,1H3/b7-6+ |
| InChIKey | VAZYVKJLUBQEEI-VOTSOKGWSA-N |
| XLogP | 2.99 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|