C17H32N2O — CID 101327577
2-[2-[(E)-dodec-1-enyl]-1,2-dihydroimidazol-3-yl]ethanol (PubChem CID 101327577) has the molecular formula C17H32N2O and a molecular weight of 280.46 g/mol. Its IUPAC name is 2-[2-[(E)-dodec-1-enyl]-1,2-dihydroimidazol-3-yl]ethanol.
| Compound Name | 2-[2-[(E)-dodec-1-enyl]-1,2-dihydroimidazol-3-yl]ethanol |
|---|---|
| PubChem CID | 101327577 |
| Molecular Formula | C17H32N2O |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.25 |
| IUPAC Name | 2-[2-[(E)-dodec-1-enyl]-1,2-dihydroimidazol-3-yl]ethanol |
| SMILES | CCCCCCCCCC/C=C/C1NC=CN1CCO |
| InChI | InChI=1S/C17H32N2O/c1-2-3-4-5-6-7-8-9-10-11-12-17-18-13-14-19(17)15-16-20/h11-14,17-18,20H,2-10,15-16H2,1H3/b12-11+ |
| InChIKey | VDQJLIFUYMFOJG-VAWYXSNFSA-N |
| XLogP | 3.77 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|