C20H39N3 — CID 101323310
1-(2-pentadec-14-enyl-4,5-dihydroimidazol-1-yl)ethanamine (PubChem CID 101323310) has the molecular formula C20H39N3 and a molecular weight of 321.55 g/mol. Its IUPAC name is 1-(2-pentadec-14-enyl-4,5-dihydroimidazol-1-yl)ethanamine.
| Compound Name | 1-(2-pentadec-14-enyl-4,5-dihydroimidazol-1-yl)ethanamine |
|---|---|
| PubChem CID | 101323310 |
| Molecular Formula | C20H39N3 |
| Molecular Weight | 321.55 g/mol |
| Exact Mass | 321.31 |
| IUPAC Name | 1-(2-pentadec-14-enyl-4,5-dihydroimidazol-1-yl)ethanamine |
| SMILES | C=CCCCCCCCCCCCCCC1=NCCN1C(C)N |
| InChI | InChI=1S/C20H39N3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20-22-17-18-23(20)19(2)21/h3,19H,1,4-18,21H2,2H3 |
| InChIKey | ZMAFMOZNKONYGO-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.55 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|