C15H28N2O — CID 101327508
2-(2-dec-9-enyl-4,5-dihydroimidazol-1-yl)ethanol (PubChem CID 101327508) has the molecular formula C15H28N2O and a molecular weight of 252.40 g/mol. Its IUPAC name is 2-(2-dec-9-enyl-4,5-dihydroimidazol-1-yl)ethanol.
| Compound Name | 2-(2-dec-9-enyl-4,5-dihydroimidazol-1-yl)ethanol |
|---|---|
| PubChem CID | 101327508 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | 2-(2-dec-9-enyl-4,5-dihydroimidazol-1-yl)ethanol |
| SMILES | C=CCCCCCCCCC1=NCCN1CCO |
| InChI | InChI=1S/C15H28N2O/c1-2-3-4-5-6-7-8-9-10-15-16-11-12-17(15)13-14-18/h2,18H,1,3-14H2 |
| InChIKey | ISSVLOWEZWKXAK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|