C32H38CaO6S2 — CID 101324485
calcium bis(4,7-dipropylnaphthalene-1-sulfonate) (PubChem CID 101324485) has the molecular formula C32H38CaO6S2 and a molecular weight of 622.86 g/mol. Its IUPAC name is calcium bis(4,7-dipropylnaphthalene-1-sulfonate).
| Compound Name | calcium bis(4,7-dipropylnaphthalene-1-sulfonate) |
|---|---|
| PubChem CID | 101324485 |
| Molecular Formula | C32H38CaO6S2 |
| Molecular Weight | 622.86 g/mol |
| Exact Mass | 622.17 |
| IUPAC Name | calcium bis(4,7-dipropylnaphthalene-1-sulfonate) |
| SMILES | CCCc1ccc2c(CCC)ccc(S(=O)(=O)[O-])c2c1.CCCc1ccc2c(CCC)ccc(S(=O)(=O)[O-])c2c1.[Ca+2] |
| InChI | InChI=1S/2C16H20O3S.Ca/c2*1-3-5-12-7-9-14-13(6-4-2)8-10-16(15(14)11-12)20(17,18)19;/h2*7-11H,3-6H2,1-2H3,(H,17,18,19);/q;;+2/p-2 |
| InChIKey | MACMQACYKHQOJR-UHFFFAOYSA-L |
| XLogP | 6.92 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.86 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|