C28H30CaO6S2 — CID 101324467
calcium bis(5,7-diethylnaphthalene-1-sulfonate) (PubChem CID 101324467) has the molecular formula C28H30CaO6S2 and a molecular weight of 566.75 g/mol. Its IUPAC name is calcium bis(5,7-diethylnaphthalene-1-sulfonate).
| Compound Name | calcium bis(5,7-diethylnaphthalene-1-sulfonate) |
|---|---|
| PubChem CID | 101324467 |
| Molecular Formula | C28H30CaO6S2 |
| Molecular Weight | 566.75 g/mol |
| Exact Mass | 566.11 |
| IUPAC Name | calcium bis(5,7-diethylnaphthalene-1-sulfonate) |
| SMILES | CCc1cc(CC)c2cccc(S(=O)(=O)[O-])c2c1.CCc1cc(CC)c2cccc(S(=O)(=O)[O-])c2c1.[Ca+2] |
| InChI | InChI=1S/2C14H16O3S.Ca/c2*1-3-10-8-11(4-2)12-6-5-7-14(13(12)9-10)18(15,16)17;/h2*5-9H,3-4H2,1-2H3,(H,15,16,17);/q;;+2/p-2 |
| InChIKey | GIOMPOKZODUSCF-UHFFFAOYSA-L |
| XLogP | 5.36 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.75 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|