C48H70CaO6S2 — CID 101324564
calcium bis(3,7-diheptylnaphthalene-1-sulfonate) (PubChem CID 101324564) has the molecular formula C48H70CaO6S2 and a molecular weight of 847.29 g/mol. Its IUPAC name is calcium bis(3,7-diheptylnaphthalene-1-sulfonate).
| Compound Name | calcium bis(3,7-diheptylnaphthalene-1-sulfonate) |
|---|---|
| PubChem CID | 101324564 |
| Molecular Formula | C48H70CaO6S2 |
| Molecular Weight | 847.29 g/mol |
| Exact Mass | 846.42 |
| IUPAC Name | calcium bis(3,7-diheptylnaphthalene-1-sulfonate) |
| SMILES | CCCCCCCc1cc(S(=O)(=O)[O-])c2cc(CCCCCCC)ccc2c1.CCCCCCCc1cc(S(=O)(=O)[O-])c2cc(CCCCCCC)ccc2c1.[Ca+2] |
| InChI | InChI=1S/2C24H36O3S.Ca/c2*1-3-5-7-9-11-13-20-15-16-22-17-21(14-12-10-8-6-4-2)19-24(23(22)18-20)28(25,26)27;/h2*15-19H,3-14H2,1-2H3,(H,25,26,27);/q;;+2/p-2 |
| InChIKey | YSCPLKQPIJMEPR-UHFFFAOYSA-L |
| XLogP | 13.16 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.29 |
| LogP ≤ 5 | 13.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|