C56H86CaO6S2 — CID 101324601
calcium bis(3,6-di(nonyl)naphthalene-1-sulfonate) (PubChem CID 101324601) has the molecular formula C56H86CaO6S2 and a molecular weight of 959.51 g/mol. Its IUPAC name is calcium bis(3,6-di(nonyl)naphthalene-1-sulfonate).
| Compound Name | calcium bis(3,6-di(nonyl)naphthalene-1-sulfonate) |
|---|---|
| PubChem CID | 101324601 |
| Molecular Formula | C56H86CaO6S2 |
| Molecular Weight | 959.51 g/mol |
| Exact Mass | 958.55 |
| IUPAC Name | calcium bis(3,6-di(nonyl)naphthalene-1-sulfonate) |
| SMILES | CCCCCCCCCc1ccc2c(S(=O)(=O)[O-])cc(CCCCCCCCC)cc2c1.CCCCCCCCCc1ccc2c(S(=O)(=O)[O-])cc(CCCCCCCCC)cc2c1.[Ca+2] |
| InChI | InChI=1S/2C28H44O3S.Ca/c2*1-3-5-7-9-11-13-15-17-24-19-20-27-26(21-24)22-25(23-28(27)32(29,30)31)18-16-14-12-10-8-6-4-2;/h2*19-23H,3-18H2,1-2H3,(H,29,30,31);/q;;+2/p-2 |
| InChIKey | NCEUDAAEZQZQDJ-UHFFFAOYSA-L |
| XLogP | 16.28 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 959.51 |
| LogP ≤ 5 | 16.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|