C21H36O6 — CID 101324822
1,3,5-tris(3-methylbut-2-enyl)cyclohexane-1,2,3,4,5,6-hexol (PubChem CID 101324822) has the molecular formula C21H36O6 and a molecular weight of 384.51 g/mol. Its IUPAC name is 1,3,5-tris(3-methylbut-2-enyl)cyclohexane-1,2,3,4,5,6-hexol.
| Compound Name | 1,3,5-tris(3-methylbut-2-enyl)cyclohexane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 101324822 |
| Molecular Formula | C21H36O6 |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | 1,3,5-tris(3-methylbut-2-enyl)cyclohexane-1,2,3,4,5,6-hexol |
| SMILES | CC(C)=CCC1(O)C(O)C(O)(CC=C(C)C)C(O)C(O)(CC=C(C)C)C1O |
| InChI | InChI=1S/C21H36O6/c1-13(2)7-10-19(25)16(22)20(26,11-8-14(3)4)18(24)21(27,17(19)23)12-9-15(5)6/h7-9,16-18,22-27H,10-12H2,1-6H3 |
| InChIKey | GASLMESBWZWBPN-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|