C27H40 — CID 101326743
1,3-ditert-butyl-2-[1-(3-tert-butylphenyl)propyl]benzene (PubChem CID 101326743) has the molecular formula C27H40 and a molecular weight of 364.62 g/mol. Its IUPAC name is 1,3-ditert-butyl-2-[1-(3-tert-butylphenyl)propyl]benzene.
| Compound Name | 1,3-ditert-butyl-2-[1-(3-tert-butylphenyl)propyl]benzene |
|---|---|
| PubChem CID | 101326743 |
| Molecular Formula | C27H40 |
| Molecular Weight | 364.62 g/mol |
| Exact Mass | 364.31 |
| IUPAC Name | 1,3-ditert-butyl-2-[1-(3-tert-butylphenyl)propyl]benzene |
| SMILES | CCC(c1cccc(C(C)(C)C)c1)c1c(C(C)(C)C)cccc1C(C)(C)C |
| InChI | InChI=1S/C27H40/c1-11-21(19-14-12-15-20(18-19)25(2,3)4)24-22(26(5,6)7)16-13-17-23(24)27(8,9)10/h12-18,21H,11H2,1-10H3 |
| InChIKey | MMTLUAXBIMXSSJ-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.62 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |