C20H38N2O — CID 101328078
1-[2-[(E)-pentadec-6-enyl]-4,5-dihydroimidazol-1-yl]ethanol (PubChem CID 101328078) has the molecular formula C20H38N2O and a molecular weight of 322.54 g/mol. Its IUPAC name is 1-[2-[(E)-pentadec-6-enyl]-4,5-dihydroimidazol-1-yl]ethanol.
| Compound Name | 1-[2-[(E)-pentadec-6-enyl]-4,5-dihydroimidazol-1-yl]ethanol |
|---|---|
| PubChem CID | 101328078 |
| Molecular Formula | C20H38N2O |
| Molecular Weight | 322.54 g/mol |
| Exact Mass | 322.30 |
| IUPAC Name | 1-[2-[(E)-pentadec-6-enyl]-4,5-dihydroimidazol-1-yl]ethanol |
| SMILES | CCCCCCCC/C=C/CCCCCC1=NCCN1C(C)O |
| InChI | InChI=1S/C20H38N2O/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20-21-17-18-22(20)19(2)23/h10-11,19,23H,3-9,12-18H2,1-2H3/b11-10+ |
| InChIKey | ZGTJKLYKUMJGMJ-ZHACJKMWSA-N |
| XLogP | 5.30 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.54 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|