C15H30N2 — CID 19844003
2-nonyl-1-propan-2-yl-4,5-dihydroimidazole (PubChem CID 19844003) has the molecular formula C15H30N2 and a molecular weight of 238.42 g/mol. Its IUPAC name is 2-nonyl-1-propan-2-yl-4,5-dihydroimidazole.
| Compound Name | 2-nonyl-1-propan-2-yl-4,5-dihydroimidazole |
|---|---|
| PubChem CID | 19844003 |
| Molecular Formula | C15H30N2 |
| Molecular Weight | 238.42 g/mol |
| Exact Mass | 238.24 |
| IUPAC Name | 2-nonyl-1-propan-2-yl-4,5-dihydroimidazole |
| SMILES | CCCCCCCCCC1=NCCN1C(C)C |
| InChI | InChI=1S/C15H30N2/c1-4-5-6-7-8-9-10-11-15-16-12-13-17(15)14(2)3/h14H,4-13H2,1-3H3 |
| InChIKey | PKFIUEDYMQDOBU-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.42 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|