C15H29N2O+ — CID 101329752
1-[3-ethyl-2-[(E)-oct-5-enyl]-1,2-dihydroimidazol-3-ium-3-yl]ethanol (PubChem CID 101329752) has the molecular formula C15H29N2O+ and a molecular weight of 253.41 g/mol. Its IUPAC name is 1-[3-ethyl-2-[(E)-oct-5-enyl]-1,2-dihydroimidazol-3-ium-3-yl]ethanol.
| Compound Name | 1-[3-ethyl-2-[(E)-oct-5-enyl]-1,2-dihydroimidazol-3-ium-3-yl]ethanol |
|---|---|
| PubChem CID | 101329752 |
| Molecular Formula | C15H29N2O+ |
| Molecular Weight | 253.41 g/mol |
| Exact Mass | 253.23 |
| IUPAC Name | 1-[3-ethyl-2-[(E)-oct-5-enyl]-1,2-dihydroimidazol-3-ium-3-yl]ethanol |
| SMILES | CC/C=C/CCCCC1NC=C[N+]1(CC)C(C)O |
| InChI | InChI=1S/C15H29N2O/c1-4-6-7-8-9-10-11-15-16-12-13-17(15,5-2)14(3)18/h6-7,12-16,18H,4-5,8-11H2,1-3H3/q+1/b7-6+ |
| InChIKey | VRIWMUQDFKWRPX-VOTSOKGWSA-N |
| XLogP | 3.09 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|