C24H46N3O+ — CID 101331367
N-[1-[3-ethyl-2-[(E)-pentadec-6-enyl]-1,2-dihydroimidazol-3-ium-3-yl]ethyl]acetamide (PubChem CID 101331367) has the molecular formula C24H46N3O+ and a molecular weight of 392.65 g/mol. Its IUPAC name is N-[1-[3-ethyl-2-[(E)-pentadec-6-enyl]-1,2-dihydroimidazol-3-ium-3-yl]ethyl]acetamide.
| Compound Name | N-[1-[3-ethyl-2-[(E)-pentadec-6-enyl]-1,2-dihydroimidazol-3-ium-3-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 101331367 |
| Molecular Formula | C24H46N3O+ |
| Molecular Weight | 392.65 g/mol |
| Exact Mass | 392.36 |
| IUPAC Name | N-[1-[3-ethyl-2-[(E)-pentadec-6-enyl]-1,2-dihydroimidazol-3-ium-3-yl]ethyl]acetamide |
| SMILES | CCCCCCCC/C=C/CCCCCC1NC=C[N+]1(CC)C(C)NC(C)=O |
| InChI | InChI=1S/C24H45N3O/c1-5-7-8-9-10-11-12-13-14-15-16-17-18-19-24-25-20-21-27(24,6-2)22(3)26-23(4)28/h13-14,20-22,24-25H,5-12,15-19H2,1-4H3/p+1/b14-13+ |
| InChIKey | DQSGUMWNSCTWKN-BUHFOSPRSA-O |
| XLogP | 5.96 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.65 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|