C18H34N3O+ — CID 101330961
N-[1-[3-ethyl-2-[(E)-non-2-enyl]-1,2-dihydroimidazol-3-ium-3-yl]ethyl]acetamide (PubChem CID 101330961) has the molecular formula C18H34N3O+ and a molecular weight of 308.49 g/mol. Its IUPAC name is N-[1-[3-ethyl-2-[(E)-non-2-enyl]-1,2-dihydroimidazol-3-ium-3-yl]ethyl]acetamide.
| Compound Name | N-[1-[3-ethyl-2-[(E)-non-2-enyl]-1,2-dihydroimidazol-3-ium-3-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 101330961 |
| Molecular Formula | C18H34N3O+ |
| Molecular Weight | 308.49 g/mol |
| Exact Mass | 308.27 |
| IUPAC Name | N-[1-[3-ethyl-2-[(E)-non-2-enyl]-1,2-dihydroimidazol-3-ium-3-yl]ethyl]acetamide |
| SMILES | CCCCCC/C=C/CC1NC=C[N+]1(CC)C(C)NC(C)=O |
| InChI | InChI=1S/C18H33N3O/c1-5-7-8-9-10-11-12-13-18-19-14-15-21(18,6-2)16(3)20-17(4)22/h11-12,14-16,18-19H,5-10,13H2,1-4H3/p+1/b12-11+ |
| InChIKey | ARLZLPJRLBFBFR-VAWYXSNFSA-O |
| XLogP | 3.62 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.49 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|