C17H32N3O+ — CID 101330919
N-[1-[3-ethyl-2-[(E)-oct-6-enyl]-1,2-dihydroimidazol-3-ium-3-yl]ethyl]acetamide (PubChem CID 101330919) has the molecular formula C17H32N3O+ and a molecular weight of 294.46 g/mol. Its IUPAC name is N-[1-[3-ethyl-2-[(E)-oct-6-enyl]-1,2-dihydroimidazol-3-ium-3-yl]ethyl]acetamide.
| Compound Name | N-[1-[3-ethyl-2-[(E)-oct-6-enyl]-1,2-dihydroimidazol-3-ium-3-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 101330919 |
| Molecular Formula | C17H32N3O+ |
| Molecular Weight | 294.46 g/mol |
| Exact Mass | 294.25 |
| IUPAC Name | N-[1-[3-ethyl-2-[(E)-oct-6-enyl]-1,2-dihydroimidazol-3-ium-3-yl]ethyl]acetamide |
| SMILES | C/C=C/CCCCCC1NC=C[N+]1(CC)C(C)NC(C)=O |
| InChI | InChI=1S/C17H31N3O/c1-5-7-8-9-10-11-12-17-18-13-14-20(17,6-2)15(3)19-16(4)21/h5,7,13-15,17-18H,6,8-12H2,1-4H3/p+1/b7-5+ |
| InChIKey | GXHJBLHWSVAHDM-FNORWQNLSA-O |
| XLogP | 3.23 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.46 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|