C16H31N2O+ — CID 101329770
2-[1-ethyl-2-[(E)-non-1-enyl]-4,5-dihydroimidazol-1-ium-1-yl]ethanol (PubChem CID 101329770) has the molecular formula C16H31N2O+ and a molecular weight of 267.44 g/mol. Its IUPAC name is 2-[1-ethyl-2-[(E)-non-1-enyl]-4,5-dihydroimidazol-1-ium-1-yl]ethanol.
| Compound Name | 2-[1-ethyl-2-[(E)-non-1-enyl]-4,5-dihydroimidazol-1-ium-1-yl]ethanol |
|---|---|
| PubChem CID | 101329770 |
| Molecular Formula | C16H31N2O+ |
| Molecular Weight | 267.44 g/mol |
| Exact Mass | 267.24 |
| IUPAC Name | 2-[1-ethyl-2-[(E)-non-1-enyl]-4,5-dihydroimidazol-1-ium-1-yl]ethanol |
| SMILES | CCCCCCC/C=C/C1=NCC[N+]1(CC)CCO |
| InChI | InChI=1S/C16H31N2O/c1-3-5-6-7-8-9-10-11-16-17-12-13-18(16,4-2)14-15-19/h10-11,19H,3-9,12-15H2,1-2H3/q+1/b11-10+ |
| InChIKey | FZFBKYKLRXWQDR-ZHACJKMWSA-N |
| XLogP | 3.14 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.44 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|