C24H47N2O+ — CID 101330333
2-[1-ethyl-2-[(E)-heptadec-6-enyl]-4,5-dihydroimidazol-1-ium-1-yl]ethanol (PubChem CID 101330333) has the molecular formula C24H47N2O+ and a molecular weight of 379.65 g/mol. Its IUPAC name is 2-[1-ethyl-2-[(E)-heptadec-6-enyl]-4,5-dihydroimidazol-1-ium-1-yl]ethanol.
| Compound Name | 2-[1-ethyl-2-[(E)-heptadec-6-enyl]-4,5-dihydroimidazol-1-ium-1-yl]ethanol |
|---|---|
| PubChem CID | 101330333 |
| Molecular Formula | C24H47N2O+ |
| Molecular Weight | 379.65 g/mol |
| Exact Mass | 379.37 |
| IUPAC Name | 2-[1-ethyl-2-[(E)-heptadec-6-enyl]-4,5-dihydroimidazol-1-ium-1-yl]ethanol |
| SMILES | CCCCCCCCCC/C=C/CCCCCC1=NCC[N+]1(CC)CCO |
| InChI | InChI=1S/C24H47N2O/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-24-25-20-21-26(24,4-2)22-23-27/h13-14,27H,3-12,15-23H2,1-2H3/q+1/b14-13+ |
| InChIKey | GXHUIYHQFCYLJX-BUHFOSPRSA-N |
| XLogP | 6.26 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.65 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|