C26H49ClN2O3 — CID 139808389
3-[1-(2-hydroxyethyl)-2-[(Z)-octadec-9-enyl]-4,5-dihydroimidazol-1-ium-1-yl]propanoic acid chloride (PubChem CID 139808389) has the molecular formula C26H49ClN2O3 and a molecular weight of 473.14 g/mol. Its IUPAC name is 3-[1-(2-hydroxyethyl)-2-[(Z)-octadec-9-enyl]-4,5-dihydroimidazol-1-ium-1-yl]propanoic acid chloride.
| Compound Name | 3-[1-(2-hydroxyethyl)-2-[(Z)-octadec-9-enyl]-4,5-dihydroimidazol-1-ium-1-yl]propanoic acid chloride |
|---|---|
| PubChem CID | 139808389 |
| Molecular Formula | C26H49ClN2O3 |
| Molecular Weight | 473.14 g/mol |
| Exact Mass | 472.34 |
| IUPAC Name | 3-[1-(2-hydroxyethyl)-2-[(Z)-octadec-9-enyl]-4,5-dihydroimidazol-1-ium-1-yl]propanoic acid chloride |
| SMILES | CCCCCCCC/C=C\CCCCCCCCC1=NCC[N+]1(CCO)CCC(=O)O.[Cl-] |
| InChI | InChI=1S/C26H48N2O3.ClH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-25-27-20-22-28(25,23-24-29)21-19-26(30)31;/h9-10,29H,2-8,11-24H2,1H3;1H/b10-9-; |
| InChIKey | FOKXZJMKTFXKKR-KVVVOXFISA-N |
| XLogP | 3.11 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.14 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|