C20H39N2O+ — CID 101330015
1-[3-ethyl-2-[(E)-tridec-2-enyl]-2,4-dihydroimidazol-3-ium-3-yl]ethanol (PubChem CID 101330015) has the molecular formula C20H39N2O+ and a molecular weight of 323.55 g/mol. Its IUPAC name is 1-[3-ethyl-2-[(E)-tridec-2-enyl]-2,4-dihydroimidazol-3-ium-3-yl]ethanol.
| Compound Name | 1-[3-ethyl-2-[(E)-tridec-2-enyl]-2,4-dihydroimidazol-3-ium-3-yl]ethanol |
|---|---|
| PubChem CID | 101330015 |
| Molecular Formula | C20H39N2O+ |
| Molecular Weight | 323.55 g/mol |
| Exact Mass | 323.31 |
| IUPAC Name | 1-[3-ethyl-2-[(E)-tridec-2-enyl]-2,4-dihydroimidazol-3-ium-3-yl]ethanol |
| SMILES | CCCCCCCCCC/C=C/CC1N=CC[N+]1(CC)C(C)O |
| InChI | InChI=1S/C20H39N2O/c1-4-6-7-8-9-10-11-12-13-14-15-16-20-21-17-18-22(20,5-2)19(3)23/h14-15,17,19-20,23H,4-13,16,18H2,1-3H3/q+1/b15-14+ |
| InChIKey | KDLYMRCRWUEISR-CCEZHUSRSA-N |
| XLogP | 5.05 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.55 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|