C21H41N2O+ — CID 101330096
1-[3-ethyl-2-[(E)-tetradec-9-enyl]-2,4-dihydroimidazol-3-ium-3-yl]ethanol (PubChem CID 101330096) has the molecular formula C21H41N2O+ and a molecular weight of 337.57 g/mol. Its IUPAC name is 1-[3-ethyl-2-[(E)-tetradec-9-enyl]-2,4-dihydroimidazol-3-ium-3-yl]ethanol.
| Compound Name | 1-[3-ethyl-2-[(E)-tetradec-9-enyl]-2,4-dihydroimidazol-3-ium-3-yl]ethanol |
|---|---|
| PubChem CID | 101330096 |
| Molecular Formula | C21H41N2O+ |
| Molecular Weight | 337.57 g/mol |
| Exact Mass | 337.32 |
| IUPAC Name | 1-[3-ethyl-2-[(E)-tetradec-9-enyl]-2,4-dihydroimidazol-3-ium-3-yl]ethanol |
| SMILES | CCCC/C=C/CCCCCCCCC1N=CC[N+]1(CC)C(C)O |
| InChI | InChI=1S/C21H41N2O/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-21-22-18-19-23(21,5-2)20(3)24/h8-9,18,20-21,24H,4-7,10-17,19H2,1-3H3/q+1/b9-8+ |
| InChIKey | WITOHWCNEZYMHA-CMDGGOBGSA-N |
| XLogP | 5.44 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.57 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|