C22H22N4O — CID 10133042
1-(2,3-dihydro-1H-inden-1-yl)-3-[N'-(naphthalen-1-ylmethyl)carbamimidoyl]urea (PubChem CID 10133042) has the molecular formula C22H22N4O and a molecular weight of 358.45 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-1-yl)-3-[N'-(naphthalen-1-ylmethyl)carbamimidoyl]urea.
| Compound Name | 1-(2,3-dihydro-1H-inden-1-yl)-3-[N'-(naphthalen-1-ylmethyl)carbamimidoyl]urea |
|---|---|
| PubChem CID | 10133042 |
| Molecular Formula | C22H22N4O |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-1-yl)-3-[N'-(naphthalen-1-ylmethyl)carbamimidoyl]urea |
| SMILES | N/C(=N\Cc1cccc2ccccc12)NC(=O)NC1CCc2ccccc21 |
| InChI | InChI=1S/C22H22N4O/c23-21(24-14-17-9-5-8-15-6-1-3-10-18(15)17)26-22(27)25-20-13-12-16-7-2-4-11-19(16)20/h1-11,20H,12-14H2,(H4,23,24,25,26,27) |
| InChIKey | PMJRVBFJYKJWFH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|