C18H34N3O+ — CID 101330950
N-[1-[3-ethyl-2-[(E)-non-7-enyl]-2,4-dihydroimidazol-3-ium-3-yl]ethyl]acetamide (PubChem CID 101330950) has the molecular formula C18H34N3O+ and a molecular weight of 308.49 g/mol. Its IUPAC name is N-[1-[3-ethyl-2-[(E)-non-7-enyl]-2,4-dihydroimidazol-3-ium-3-yl]ethyl]acetamide.
| Compound Name | N-[1-[3-ethyl-2-[(E)-non-7-enyl]-2,4-dihydroimidazol-3-ium-3-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 101330950 |
| Molecular Formula | C18H34N3O+ |
| Molecular Weight | 308.49 g/mol |
| Exact Mass | 308.27 |
| IUPAC Name | N-[1-[3-ethyl-2-[(E)-non-7-enyl]-2,4-dihydroimidazol-3-ium-3-yl]ethyl]acetamide |
| SMILES | C/C=C/CCCCCCC1N=CC[N+]1(CC)C(C)NC(C)=O |
| InChI | InChI=1S/C18H33N3O/c1-5-7-8-9-10-11-12-13-18-19-14-15-21(18,6-2)16(3)20-17(4)22/h5,7,14,16,18H,6,8-13,15H2,1-4H3/p+1/b7-5+ |
| InChIKey | NMKUMFFMRNHSMX-FNORWQNLSA-O |
| XLogP | 3.63 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.49 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|