C27H26O — CID 101333517
2-tert-butyl-6-(3,4-diphenylcyclopenta-2,4-dien-1-yl)phenol (PubChem CID 101333517) has the molecular formula C27H26O and a molecular weight of 366.50 g/mol. Its IUPAC name is 2-tert-butyl-6-(3,4-diphenylcyclopenta-2,4-dien-1-yl)phenol.
| Compound Name | 2-tert-butyl-6-(3,4-diphenylcyclopenta-2,4-dien-1-yl)phenol |
|---|---|
| PubChem CID | 101333517 |
| Molecular Formula | C27H26O |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | 2-tert-butyl-6-(3,4-diphenylcyclopenta-2,4-dien-1-yl)phenol |
| SMILES | CC(C)(C)c1cccc(C2C=C(c3ccccc3)C(c3ccccc3)=C2)c1O |
| InChI | InChI=1S/C27H26O/c1-27(2,3)25-16-10-15-22(26(25)28)21-17-23(19-11-6-4-7-12-19)24(18-21)20-13-8-5-9-14-20/h4-18,21,28H,1-3H3 |
| InChIKey | YJSVZWAHARIKCA-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |