C38H24F6N2O2S2 — CID 101334608
2-[3-[2-[6-(1,3-dioxolan-2-yl)-2-methyl-1-benzothiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2-methyl-1-benzothiophen-6-yl]-1,10-phenanthroline (PubChem CID 101334608) has the molecular formula C38H24F6N2O2S2 and a molecular weight of 718.74 g/mol. Its IUPAC name is 2-[3-[2-[6-(1,3-dioxolan-2-yl)-2-methyl-1-benzothiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2-methyl-1-benzothiophen-6-yl]-1,10-phenanthroline.
| Compound Name | 2-[3-[2-[6-(1,3-dioxolan-2-yl)-2-methyl-1-benzothiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2-methyl-1-benzothiophen-6-yl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 101334608 |
| Molecular Formula | C38H24F6N2O2S2 |
| Molecular Weight | 718.74 g/mol |
| Exact Mass | 718.12 |
| IUPAC Name | 2-[3-[2-[6-(1,3-dioxolan-2-yl)-2-methyl-1-benzothiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2-methyl-1-benzothiophen-6-yl]-1,10-phenanthroline |
| SMILES | Cc1sc2cc(-c3ccc4ccc5cccnc5c4n3)ccc2c1C1=C(c2c(C)sc3cc(C4OCCO4)ccc23)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C38H24F6N2O2S2/c1-18-29(24-10-7-22(16-27(24)49-18)26-12-9-21-6-5-20-4-3-13-45-33(20)34(21)46-26)31-32(37(41,42)38(43,44)36(31,39)40)30-19(2)50-28-17-23(8-11-25(28)30)35-47-14-15-48-35/h3-13,16-17,35H,14-15H2,1-2H3 |
| InChIKey | VFVAUXPQUUADIK-UHFFFAOYSA-N |
| XLogP | 11.37 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.74 |
| LogP ≤ 5 | 11.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|