C38H28N2O2S2+2 — CID 91112994
3,10-bis(5-methylthiophen-2-yl)-4',6'-diphenylspiro[1,12-diazoniatetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8,10,12-heptaene-15,2'-4H-1,3-dioxine] (PubChem CID 91112994) has the molecular formula C38H28N2O2S2+2 and a molecular weight of 608.79 g/mol. Its IUPAC name is 3,10-bis(5-methylthiophen-2-yl)-4',6'-diphenylspiro[1,12-diazoniatetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8,10,12-heptaene-15,2'-4H-1,3-dioxine].
| Compound Name | 3,10-bis(5-methylthiophen-2-yl)-4',6'-diphenylspiro[1,12-diazoniatetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8,10,12-heptaene-15,2'-4H-1,3-dioxine] |
|---|---|
| PubChem CID | 91112994 |
| Molecular Formula | C38H28N2O2S2+2 |
| Molecular Weight | 608.79 g/mol |
| Exact Mass | 608.16 |
| IUPAC Name | 3,10-bis(5-methylthiophen-2-yl)-4',6'-diphenylspiro[1,12-diazoniatetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8,10,12-heptaene-15,2'-4H-1,3-dioxine] |
| SMILES | Cc1ccc(-c2cc3ccc4cc(-c5ccc(C)s5)c[n+]5c4c3[n+](c2)C52OC(c3ccccc3)=CC(c3ccccc3)O2)s1 |
| InChI | InChI=1S/C38H28N2O2S2/c1-24-13-17-34(43-24)30-19-28-15-16-29-20-31(35-18-14-25(2)44-35)23-40-37(29)36(28)39(22-30)38(40)41-32(26-9-5-3-6-10-26)21-33(42-38)27-11-7-4-8-12-27/h3-23,32H,1-2H3/q+2 |
| InChIKey | JJQKOGOGYZKPIV-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 26.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.79 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|