C40H30N2O2+2 — CID 59824653
4,4',6',9-tetraphenylspiro[1,12-diazoniatetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8,10,12-heptaene-15,2'-1,3-dioxane] (PubChem CID 59824653) has the molecular formula C40H30N2O2+2 and a molecular weight of 570.69 g/mol. Its IUPAC name is 4,4',6',9-tetraphenylspiro[1,12-diazoniatetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8,10,12-heptaene-15,2'-1,3-dioxane].
| Compound Name | 4,4',6',9-tetraphenylspiro[1,12-diazoniatetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8,10,12-heptaene-15,2'-1,3-dioxane] |
|---|---|
| PubChem CID | 59824653 |
| Molecular Formula | C40H30N2O2+2 |
| Molecular Weight | 570.69 g/mol |
| Exact Mass | 570.23 |
| IUPAC Name | 4,4',6',9-tetraphenylspiro[1,12-diazoniatetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8,10,12-heptaene-15,2'-1,3-dioxane] |
| SMILES | c1ccc(-c2cc[n+]3c4c2ccc2c(-c5ccccc5)cc[n+](c24)C32OC(c3ccccc3)CC(c3ccccc3)O2)cc1 |
| InChI | InChI=1S/C40H30N2O2/c1-5-13-28(14-6-1)32-23-25-41-38-34(32)21-22-35-33(29-15-7-2-8-16-29)24-26-42(39(35)38)40(41)43-36(30-17-9-3-10-18-30)27-37(44-40)31-19-11-4-12-20-31/h1-26,36-37H,27H2/q+2 |
| InChIKey | YJVXTQPSIGCSSF-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 26.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.69 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|