C27H22EuN2O2 — CID 58649421
(Z)-1,3-diphenylprop-1-ene-1,3-diol;europium;1,10-phenanthroline (PubChem CID 58649421) has the molecular formula C27H22EuN2O2 and a molecular weight of 558.45 g/mol. Its IUPAC name is (Z)-1,3-diphenylprop-1-ene-1,3-diol;europium;1,10-phenanthroline.
| Compound Name | (Z)-1,3-diphenylprop-1-ene-1,3-diol;europium;1,10-phenanthroline |
|---|---|
| PubChem CID | 58649421 |
| Molecular Formula | C27H22EuN2O2 |
| Molecular Weight | 558.45 g/mol |
| Exact Mass | 559.09 |
| IUPAC Name | (Z)-1,3-diphenylprop-1-ene-1,3-diol;europium;1,10-phenanthroline |
| SMILES | O/C(=C\C(O)c1ccccc1)c1ccccc1.[Eu].c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C15H14O2.C12H8N2.Eu/c16-14(12-7-3-1-4-8-12)11-15(17)13-9-5-2-6-10-13;1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;/h1-11,14,16-17H;1-8H;/b15-11-;; |
| InChIKey | WRJMWEHQFPUVQU-VGUYJMDASA-N |
| XLogP | 6.10 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.45 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|