C28H19EuF3N2O2 — CID 20606778
europium;1,10-phenanthroline;2,2,2-trifluoro-1-(1-hydroxy-3,4-dihydroanthracen-2-yl)ethanone (PubChem CID 20606778) has the molecular formula C28H19EuF3N2O2 and a molecular weight of 624.43 g/mol. Its IUPAC name is europium;1,10-phenanthroline;2,2,2-trifluoro-1-(1-hydroxy-3,4-dihydroanthracen-2-yl)ethanone.
| Compound Name | europium;1,10-phenanthroline;2,2,2-trifluoro-1-(1-hydroxy-3,4-dihydroanthracen-2-yl)ethanone |
|---|---|
| PubChem CID | 20606778 |
| Molecular Formula | C28H19EuF3N2O2 |
| Molecular Weight | 624.43 g/mol |
| Exact Mass | 625.06 |
| IUPAC Name | europium;1,10-phenanthroline;2,2,2-trifluoro-1-(1-hydroxy-3,4-dihydroanthracen-2-yl)ethanone |
| SMILES | O=C(C1=C(O)c2cc3ccccc3cc2CC1)C(F)(F)F.[Eu].c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C16H11F3O2.C12H8N2.Eu/c17-16(18,19)15(21)12-6-5-11-7-9-3-1-2-4-10(9)8-13(11)14(12)20;1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;/h1-4,7-8,20H,5-6H2;1-8H; |
| InChIKey | ZAYSCAFVMQRLLJ-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.43 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|