C24H15EuF3N2O2 — CID 20606762
europium;1,10-phenanthroline;2,2,2-trifluoro-1-(1-hydroxynaphthalen-2-yl)ethanone (PubChem CID 20606762) has the molecular formula C24H15EuF3N2O2 and a molecular weight of 572.35 g/mol. Its IUPAC name is europium;1,10-phenanthroline;2,2,2-trifluoro-1-(1-hydroxynaphthalen-2-yl)ethanone.
| Compound Name | europium;1,10-phenanthroline;2,2,2-trifluoro-1-(1-hydroxynaphthalen-2-yl)ethanone |
|---|---|
| PubChem CID | 20606762 |
| Molecular Formula | C24H15EuF3N2O2 |
| Molecular Weight | 572.35 g/mol |
| Exact Mass | 573.03 |
| IUPAC Name | europium;1,10-phenanthroline;2,2,2-trifluoro-1-(1-hydroxynaphthalen-2-yl)ethanone |
| SMILES | O=C(c1ccc2ccccc2c1O)C(F)(F)F.[Eu].c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C12H7F3O2.C12H8N2.Eu/c13-12(14,15)11(17)9-6-5-7-3-1-2-4-8(7)10(9)16;1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;/h1-6,16H;1-8H; |
| InChIKey | RXDHVBWOJNODHR-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.35 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|