C20H11EuF5N2O2 — CID 20606756
1-(3,5-difluoro-2-hydroxyphenyl)-2,2,2-trifluoroethanone;europium;1,10-phenanthroline (PubChem CID 20606756) has the molecular formula C20H11EuF5N2O2 and a molecular weight of 558.27 g/mol. Its IUPAC name is 1-(3,5-difluoro-2-hydroxyphenyl)-2,2,2-trifluoroethanone;europium;1,10-phenanthroline.
| Compound Name | 1-(3,5-difluoro-2-hydroxyphenyl)-2,2,2-trifluoroethanone;europium;1,10-phenanthroline |
|---|---|
| PubChem CID | 20606756 |
| Molecular Formula | C20H11EuF5N2O2 |
| Molecular Weight | 558.27 g/mol |
| Exact Mass | 559.00 |
| IUPAC Name | 1-(3,5-difluoro-2-hydroxyphenyl)-2,2,2-trifluoroethanone;europium;1,10-phenanthroline |
| SMILES | O=C(c1cc(F)cc(F)c1O)C(F)(F)F.[Eu].c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C12H8N2.C8H3F5O2.Eu/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;9-3-1-4(6(14)5(10)2-3)7(15)8(11,12)13;/h1-8H;1-2,14H; |
| InChIKey | YUISNYLVMBOKIT-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.27 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|