C32H19EuF5N2O2 — CID 20606788
1-(3,5-difluoro-2-hydroxyphenyl)-2,2,2-trifluoroethanone;4,7-diphenyl-1,10-phenanthroline;europium (PubChem CID 20606788) has the molecular formula C32H19EuF5N2O2 and a molecular weight of 710.47 g/mol. Its IUPAC name is 1-(3,5-difluoro-2-hydroxyphenyl)-2,2,2-trifluoroethanone;4,7-diphenyl-1,10-phenanthroline;europium.
| Compound Name | 1-(3,5-difluoro-2-hydroxyphenyl)-2,2,2-trifluoroethanone;4,7-diphenyl-1,10-phenanthroline;europium |
|---|---|
| PubChem CID | 20606788 |
| Molecular Formula | C32H19EuF5N2O2 |
| Molecular Weight | 710.47 g/mol |
| Exact Mass | 711.06 |
| IUPAC Name | 1-(3,5-difluoro-2-hydroxyphenyl)-2,2,2-trifluoroethanone;4,7-diphenyl-1,10-phenanthroline;europium |
| SMILES | O=C(c1cc(F)cc(F)c1O)C(F)(F)F.[Eu].c1ccc(-c2ccnc3c2ccc2c(-c4ccccc4)ccnc23)cc1 |
| InChI | InChI=1S/C24H16N2.C8H3F5O2.Eu/c1-3-7-17(8-4-1)19-13-15-25-23-21(19)11-12-22-20(14-16-26-24(22)23)18-9-5-2-6-10-18;9-3-1-4(6(14)5(10)2-3)7(15)8(11,12)13;/h1-16H;1-2,14H; |
| InChIKey | JKBNTYWQVKVCAJ-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.47 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|