C36H25EuF3N2O2 — CID 20606787
4,7-diphenyl-1,10-phenanthroline;europium;2,2,2-trifluoro-1-(1-hydroxy-3,4-dihydronaphthalen-2-yl)ethanone (PubChem CID 20606787) has the molecular formula C36H25EuF3N2O2 and a molecular weight of 726.57 g/mol. Its IUPAC name is 4,7-diphenyl-1,10-phenanthroline;europium;2,2,2-trifluoro-1-(1-hydroxy-3,4-dihydronaphthalen-2-yl)ethanone.
| Compound Name | 4,7-diphenyl-1,10-phenanthroline;europium;2,2,2-trifluoro-1-(1-hydroxy-3,4-dihydronaphthalen-2-yl)ethanone |
|---|---|
| PubChem CID | 20606787 |
| Molecular Formula | C36H25EuF3N2O2 |
| Molecular Weight | 726.57 g/mol |
| Exact Mass | 727.11 |
| IUPAC Name | 4,7-diphenyl-1,10-phenanthroline;europium;2,2,2-trifluoro-1-(1-hydroxy-3,4-dihydronaphthalen-2-yl)ethanone |
| SMILES | O=C(C1=C(O)c2ccccc2CC1)C(F)(F)F.[Eu].c1ccc(-c2ccnc3c2ccc2c(-c4ccccc4)ccnc23)cc1 |
| InChI | InChI=1S/C24H16N2.C12H9F3O2.Eu/c1-3-7-17(8-4-1)19-13-15-25-23-21(19)11-12-22-20(14-16-26-24(22)23)18-9-5-2-6-10-18;13-12(14,15)11(17)9-6-5-7-3-1-2-4-8(7)10(9)16;/h1-16H;1-4,16H,5-6H2; |
| InChIKey | MLUBYUNGYUTULQ-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.57 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|