C17H10F6N2O2Tb — CID 20606759
(Z)-1,1,1,5,5,5-hexafluoro-4-hydroxypent-3-en-2-one;1,10-phenanthroline;terbium (PubChem CID 20606759) has the molecular formula C17H10F6N2O2Tb and a molecular weight of 547.19 g/mol. Its IUPAC name is (Z)-1,1,1,5,5,5-hexafluoro-4-hydroxypent-3-en-2-one;1,10-phenanthroline;terbium.
| Compound Name | (Z)-1,1,1,5,5,5-hexafluoro-4-hydroxypent-3-en-2-one;1,10-phenanthroline;terbium |
|---|---|
| PubChem CID | 20606759 |
| Molecular Formula | C17H10F6N2O2Tb |
| Molecular Weight | 547.19 g/mol |
| Exact Mass | 546.99 |
| IUPAC Name | (Z)-1,1,1,5,5,5-hexafluoro-4-hydroxypent-3-en-2-one;1,10-phenanthroline;terbium |
| SMILES | O=C(/C=C(\O)C(F)(F)F)C(F)(F)F.[Tb].c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C12H8N2.C5H2F6O2.Tb/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;6-4(7,8)2(12)1-3(13)5(9,10)11;/h1-8H;1,12H;/b;2-1-; |
| InChIKey | FXQDNNCOBQOCRG-FJOGWHKWSA-N |
| XLogP | 4.91 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.19 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|