C40H25EuF3N2O2 — CID 20798408
4,7-diphenyl-1,10-phenanthroline;europium;2,2,2-trifluoro-1-(1-hydroxyanthracen-2-yl)ethanone (PubChem CID 20798408) has the molecular formula C40H25EuF3N2O2 and a molecular weight of 774.61 g/mol. Its IUPAC name is 4,7-diphenyl-1,10-phenanthroline;europium;2,2,2-trifluoro-1-(1-hydroxyanthracen-2-yl)ethanone.
| Compound Name | 4,7-diphenyl-1,10-phenanthroline;europium;2,2,2-trifluoro-1-(1-hydroxyanthracen-2-yl)ethanone |
|---|---|
| PubChem CID | 20798408 |
| Molecular Formula | C40H25EuF3N2O2 |
| Molecular Weight | 774.61 g/mol |
| Exact Mass | 775.11 |
| IUPAC Name | 4,7-diphenyl-1,10-phenanthroline;europium;2,2,2-trifluoro-1-(1-hydroxyanthracen-2-yl)ethanone |
| SMILES | O=C(c1ccc2cc3ccccc3cc2c1O)C(F)(F)F.[Eu].c1ccc(-c2ccnc3c2ccc2c(-c4ccccc4)ccnc23)cc1 |
| InChI | InChI=1S/C24H16N2.C16H9F3O2.Eu/c1-3-7-17(8-4-1)19-13-15-25-23-21(19)11-12-22-20(14-16-26-24(22)23)18-9-5-2-6-10-18;17-16(18,19)15(21)12-6-5-11-7-9-3-1-2-4-10(9)8-13(11)14(12)20;/h1-16H;1-8,20H; |
| InChIKey | HAOSPPFAOJXROZ-UHFFFAOYSA-N |
| XLogP | 10.56 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.61 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|