C28H27F2N3O — CID 10298197
1,1-bis(4-fluorophenyl)-3-(4-quinolin-8-ylpiperazin-1-yl)propan-1-ol (PubChem CID 10298197) has the molecular formula C28H27F2N3O and a molecular weight of 459.54 g/mol. Its IUPAC name is 1,1-bis(4-fluorophenyl)-3-(4-quinolin-8-ylpiperazin-1-yl)propan-1-ol.
| Compound Name | 1,1-bis(4-fluorophenyl)-3-(4-quinolin-8-ylpiperazin-1-yl)propan-1-ol |
|---|---|
| PubChem CID | 10298197 |
| Molecular Formula | C28H27F2N3O |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | 1,1-bis(4-fluorophenyl)-3-(4-quinolin-8-ylpiperazin-1-yl)propan-1-ol |
| SMILES | OC(CCN1CCN(c2cccc3cccnc23)CC1)(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C28H27F2N3O/c29-24-10-6-22(7-11-24)28(34,23-8-12-25(30)13-9-23)14-16-32-17-19-33(20-18-32)26-5-1-3-21-4-2-15-31-27(21)26/h1-13,15,34H,14,16-20H2 |
| InChIKey | LOMJZFFDCUBDIL-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |