C24H27N5O2 — CID 142681677
6-[4-(4-quinolin-8-ylpiperazin-1-yl)butoxy]-4H-pyrido[3,2-b][1,4]oxazine (PubChem CID 142681677) has the molecular formula C24H27N5O2 and a molecular weight of 417.51 g/mol. Its IUPAC name is 6-[4-(4-quinolin-8-ylpiperazin-1-yl)butoxy]-4H-pyrido[3,2-b][1,4]oxazine.
| Compound Name | 6-[4-(4-quinolin-8-ylpiperazin-1-yl)butoxy]-4H-pyrido[3,2-b][1,4]oxazine |
|---|---|
| PubChem CID | 142681677 |
| Molecular Formula | C24H27N5O2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | 6-[4-(4-quinolin-8-ylpiperazin-1-yl)butoxy]-4H-pyrido[3,2-b][1,4]oxazine |
| SMILES | C1=COc2ccc(OCCCCN3CCN(c4cccc5cccnc45)CC3)nc2N1 |
| InChI | InChI=1S/C24H27N5O2/c1(2-17-31-22-9-8-21-24(27-22)26-11-18-30-21)12-28-13-15-29(16-14-28)20-7-3-5-19-6-4-10-25-23(19)20/h3-11,18H,1-2,12-17H2,(H,26,27) |
| InChIKey | SRPLSRLQDYMQOB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|