C36H28N2O2S2+2 — CID 91112993
5',11'-bis(5-methylthiophen-2-yl)-4,6-diphenylspiro[4H-1,3-dioxine-2,8'-7,9-diazoniatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene] (PubChem CID 91112993) has the molecular formula C36H28N2O2S2+2 and a molecular weight of 584.77 g/mol. Its IUPAC name is 5',11'-bis(5-methylthiophen-2-yl)-4,6-diphenylspiro[4H-1,3-dioxine-2,8'-7,9-diazoniatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene].
| Compound Name | 5',11'-bis(5-methylthiophen-2-yl)-4,6-diphenylspiro[4H-1,3-dioxine-2,8'-7,9-diazoniatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene] |
|---|---|
| PubChem CID | 91112993 |
| Molecular Formula | C36H28N2O2S2+2 |
| Molecular Weight | 584.77 g/mol |
| Exact Mass | 584.16 |
| IUPAC Name | 5',11'-bis(5-methylthiophen-2-yl)-4,6-diphenylspiro[4H-1,3-dioxine-2,8'-7,9-diazoniatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene] |
| SMILES | Cc1ccc(-c2ccc3[n+](c2)C2(OC(c4ccccc4)=CC(c4ccccc4)O2)[n+]2cc(-c4ccc(C)s4)ccc2-3)s1 |
| InChI | InChI=1S/C36H28N2O2S2/c1-24-13-19-34(41-24)28-15-17-30-31-18-16-29(35-20-14-25(2)42-35)23-38(31)36(37(30)22-28)39-32(26-9-5-3-6-10-26)21-33(40-36)27-11-7-4-8-12-27/h3-23,32H,1-2H3/q+2 |
| InChIKey | VMPITDPWGQXFGX-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 26.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.77 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|